C8H14N4O2S — CID 114615039
5-amino-3-methyl-N-(2-methylprop-2-enyl)imidazole-4-sulfonamide (PubChem CID 114615039) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 5-amino-3-methyl-N-(2-methylprop-2-enyl)imidazole-4-sulfonamide.
| Compound Name | 5-amino-3-methyl-N-(2-methylprop-2-enyl)imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 114615039 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 5-amino-3-methyl-N-(2-methylprop-2-enyl)imidazole-4-sulfonamide |
| SMILES | C=C(C)CNS(=O)(=O)c1c(N)ncn1C |
| InChI | InChI=1S/C8H14N4O2S/c1-6(2)4-11-15(13,14)8-7(9)10-5-12(8)3/h5,11H,1,4,9H2,2-3H3 |
| InChIKey | VBHYLNXUNOUVKD-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|