C10H18N4O2S2 — CID 113487202
5-amino-3-methyl-N-(thian-4-ylmethyl)imidazole-4-sulfonamide (PubChem CID 113487202) has the molecular formula C10H18N4O2S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 5-amino-3-methyl-N-(thian-4-ylmethyl)imidazole-4-sulfonamide.
| Compound Name | 5-amino-3-methyl-N-(thian-4-ylmethyl)imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 113487202 |
| Molecular Formula | C10H18N4O2S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 5-amino-3-methyl-N-(thian-4-ylmethyl)imidazole-4-sulfonamide |
| SMILES | Cn1cnc(N)c1S(=O)(=O)NCC1CCSCC1 |
| InChI | InChI=1S/C10H18N4O2S2/c1-14-7-12-9(11)10(14)18(15,16)13-6-8-2-4-17-5-3-8/h7-8,13H,2-6,11H2,1H3 |
| InChIKey | IBJTVEXFIMHWRW-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |