C8H13N3O3S — CID 65427987
2-amino-N-(1-hydroxypropan-2-yl)pyridine-3-sulfonamide (PubChem CID 65427987) has the molecular formula C8H13N3O3S and a molecular weight of 231.28 g/mol. Its IUPAC name is 2-amino-N-(1-hydroxypropan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-N-(1-hydroxypropan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 65427987 |
| Molecular Formula | C8H13N3O3S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 2-amino-N-(1-hydroxypropan-2-yl)pyridine-3-sulfonamide |
| SMILES | CC(CO)NS(=O)(=O)c1cccnc1N |
| InChI | InChI=1S/C8H13N3O3S/c1-6(5-12)11-15(13,14)7-3-2-4-10-8(7)9/h2-4,6,11-12H,5H2,1H3,(H2,9,10) |
| InChIKey | DWTMOSOEPXPHTK-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |