C10H17N3O2S — CID 62149159
2-amino-N-pentan-3-ylpyridine-3-sulfonamide (PubChem CID 62149159) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-amino-N-pentan-3-ylpyridine-3-sulfonamide.
| Compound Name | 2-amino-N-pentan-3-ylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62149159 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-amino-N-pentan-3-ylpyridine-3-sulfonamide |
| SMILES | CCC(CC)NS(=O)(=O)c1cccnc1N |
| InChI | InChI=1S/C10H17N3O2S/c1-3-8(4-2)13-16(14,15)9-6-5-7-12-10(9)11/h5-8,13H,3-4H2,1-2H3,(H2,11,12) |
| InChIKey | YVSYJTRXAMAHDX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |