C15H18N4O4S2 — CID 20939789
5-(6-oxo-1H-pyridazin-3-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]thiophene-2-sulfonamide (PubChem CID 20939789) has the molecular formula C15H18N4O4S2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 5-(6-oxo-1H-pyridazin-3-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]thiophene-2-sulfonamide.
| Compound Name | 5-(6-oxo-1H-pyridazin-3-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 20939789 |
| Molecular Formula | C15H18N4O4S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 5-(6-oxo-1H-pyridazin-3-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]thiophene-2-sulfonamide |
| SMILES | O=C1CCCN1CCCNS(=O)(=O)c1ccc(-c2ccc(=O)[nH]n2)s1 |
| InChI | InChI=1S/C15H18N4O4S2/c20-13-6-4-11(17-18-13)12-5-7-15(24-12)25(22,23)16-8-2-10-19-9-1-3-14(19)21/h4-7,16H,1-3,8-10H2,(H,18,20) |
| InChIKey | VWGASSQMMNCCOV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|