C17H19N3O3S2 — CID 20947504
N-[(4-ethoxyphenyl)methyl]-5-(5-methyl-1H-pyrazol-3-yl)thiophene-2-sulfonamide (PubChem CID 20947504) has the molecular formula C17H19N3O3S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-[(4-ethoxyphenyl)methyl]-5-(5-methyl-1H-pyrazol-3-yl)thiophene-2-sulfonamide.
| Compound Name | N-[(4-ethoxyphenyl)methyl]-5-(5-methyl-1H-pyrazol-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 20947504 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-[(4-ethoxyphenyl)methyl]-5-(5-methyl-1H-pyrazol-3-yl)thiophene-2-sulfonamide |
| SMILES | CCOc1ccc(CNS(=O)(=O)c2ccc(-c3cc(C)[nH]n3)s2)cc1 |
| InChI | InChI=1S/C17H19N3O3S2/c1-3-23-14-6-4-13(5-7-14)11-18-25(21,22)17-9-8-16(24-17)15-10-12(2)19-20-15/h4-10,18H,3,11H2,1-2H3,(H,19,20) |
| InChIKey | SDYFDOVBELUJJX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |