C15H12F3N3O2S2 — CID 53083784
N-benzyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-2-sulfonamide (PubChem CID 53083784) has the molecular formula C15H12F3N3O2S2 and a molecular weight of 387.41 g/mol. Its IUPAC name is N-benzyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-benzyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 53083784 |
| Molecular Formula | C15H12F3N3O2S2 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | N-benzyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1)c1ccc(-c2cc(C(F)(F)F)[nH]n2)s1 |
| InChI | InChI=1S/C15H12F3N3O2S2/c16-15(17,18)13-8-11(20-21-13)12-6-7-14(24-12)25(22,23)19-9-10-4-2-1-3-5-10/h1-8,19H,9H2,(H,20,21) |
| InChIKey | HMXXQAGNSBIRJX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |