C15H12F3N3O2S2 — CID 46396444
2-methyl-N-phenyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-3-sulfonamide (PubChem CID 46396444) has the molecular formula C15H12F3N3O2S2 and a molecular weight of 387.41 g/mol. Its IUPAC name is 2-methyl-N-phenyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-3-sulfonamide.
| Compound Name | 2-methyl-N-phenyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 46396444 |
| Molecular Formula | C15H12F3N3O2S2 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 2-methyl-N-phenyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-3-sulfonamide |
| SMILES | Cc1sc(-c2cc(C(F)(F)F)[nH]n2)cc1S(=O)(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H12F3N3O2S2/c1-9-13(25(22,23)21-10-5-3-2-4-6-10)8-12(24-9)11-7-14(20-19-11)15(16,17)18/h2-8,21H,1H3,(H,19,20) |
| InChIKey | AKDCYHOOKBGCTL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |