C16H14F3N3O3S2 — CID 53083736
N-(4-ethoxyphenyl)-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-2-sulfonamide (PubChem CID 53083736) has the molecular formula C16H14F3N3O3S2 and a molecular weight of 417.43 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-(4-ethoxyphenyl)-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 53083736 |
| Molecular Formula | C16H14F3N3O3S2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | N-(4-ethoxyphenyl)-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]thiophene-2-sulfonamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(-c3cc(C(F)(F)F)[nH]n3)s2)cc1 |
| InChI | InChI=1S/C16H14F3N3O3S2/c1-2-25-11-5-3-10(4-6-11)22-27(23,24)15-8-7-13(26-15)12-9-14(21-20-12)16(17,18)19/h3-9,22H,2H2,1H3,(H,20,21) |
| InChIKey | MFQRTMIEHLNAOQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |