C17H23N3O6S2 — CID 20950045
ethyl 5-[5-(3-morpholin-4-ylpropylsulfamoyl)thiophen-2-yl]-1,2-oxazole-3-carboxylate (PubChem CID 20950045) has the molecular formula C17H23N3O6S2 and a molecular weight of 429.52 g/mol. Its IUPAC name is ethyl 5-[5-(3-morpholin-4-ylpropylsulfamoyl)thiophen-2-yl]-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-[5-(3-morpholin-4-ylpropylsulfamoyl)thiophen-2-yl]-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 20950045 |
| Molecular Formula | C17H23N3O6S2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | ethyl 5-[5-(3-morpholin-4-ylpropylsulfamoyl)thiophen-2-yl]-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(S(=O)(=O)NCCCN3CCOCC3)s2)on1 |
| InChI | InChI=1S/C17H23N3O6S2/c1-2-25-17(21)13-12-14(26-19-13)15-4-5-16(27-15)28(22,23)18-6-3-7-20-8-10-24-11-9-20/h4-5,12,18H,2-3,6-11H2,1H3 |
| InChIKey | RBOZPSLUTCBLSS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|