C17H18N2O6S2 — CID 20950118
ethyl 5-[5-[3-(furan-2-yl)propylsulfamoyl]thiophen-2-yl]-1,2-oxazole-3-carboxylate (PubChem CID 20950118) has the molecular formula C17H18N2O6S2 and a molecular weight of 410.47 g/mol. Its IUPAC name is ethyl 5-[5-[3-(furan-2-yl)propylsulfamoyl]thiophen-2-yl]-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-[5-[3-(furan-2-yl)propylsulfamoyl]thiophen-2-yl]-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 20950118 |
| Molecular Formula | C17H18N2O6S2 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | ethyl 5-[5-[3-(furan-2-yl)propylsulfamoyl]thiophen-2-yl]-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(S(=O)(=O)NCCCc3ccco3)s2)on1 |
| InChI | InChI=1S/C17H18N2O6S2/c1-2-23-17(20)13-11-14(25-19-13)15-7-8-16(26-15)27(21,22)18-9-3-5-12-6-4-10-24-12/h4,6-8,10-11,18H,2-3,5,9H2,1H3 |
| InChIKey | ARXGOCMGIYFRJK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|