C11H13N3O5S — CID 22579173
ethyl 5-(furan-2-ylmethylsulfamoyl)-1H-pyrazole-3-carboxylate (PubChem CID 22579173) has the molecular formula C11H13N3O5S and a molecular weight of 299.31 g/mol. Its IUPAC name is ethyl 5-(furan-2-ylmethylsulfamoyl)-1H-pyrazole-3-carboxylate.
| Compound Name | ethyl 5-(furan-2-ylmethylsulfamoyl)-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 22579173 |
| Molecular Formula | C11H13N3O5S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | ethyl 5-(furan-2-ylmethylsulfamoyl)-1H-pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)NCc2ccco2)[nH]n1 |
| InChI | InChI=1S/C11H13N3O5S/c1-2-18-11(15)9-6-10(14-13-9)20(16,17)12-7-8-4-3-5-19-8/h3-6,12H,2,7H2,1H3,(H,13,14) |
| InChIKey | ORJBLUUQXVSDSO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |