C13H14FN3O4S — CID 22579147
ethyl 5-[(3-fluoro-4-methylphenyl)sulfamoyl]-1H-pyrazole-3-carboxylate (PubChem CID 22579147) has the molecular formula C13H14FN3O4S and a molecular weight of 327.34 g/mol. Its IUPAC name is ethyl 5-[(3-fluoro-4-methylphenyl)sulfamoyl]-1H-pyrazole-3-carboxylate.
| Compound Name | ethyl 5-[(3-fluoro-4-methylphenyl)sulfamoyl]-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 22579147 |
| Molecular Formula | C13H14FN3O4S |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | ethyl 5-[(3-fluoro-4-methylphenyl)sulfamoyl]-1H-pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)Nc2ccc(C)c(F)c2)[nH]n1 |
| InChI | InChI=1S/C13H14FN3O4S/c1-3-21-13(18)11-7-12(16-15-11)22(19,20)17-9-5-4-8(2)10(14)6-9/h4-7,17H,3H2,1-2H3,(H,15,16) |
| InChIKey | HOYQZBJZJBNOGP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |