C8H14BrClN2O2S2 — CID 119972869
3-bromo-5-methyl-N-[2-(methylamino)ethyl]thiophene-2-sulfonamide;hydrochloride (PubChem CID 119972869) has the molecular formula C8H14BrClN2O2S2 and a molecular weight of 349.70 g/mol. Its IUPAC name is 3-bromo-5-methyl-N-[2-(methylamino)ethyl]thiophene-2-sulfonamide;hydrochloride.
| Compound Name | 3-bromo-5-methyl-N-[2-(methylamino)ethyl]thiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119972869 |
| Molecular Formula | C8H14BrClN2O2S2 |
| Molecular Weight | 349.70 g/mol |
| Exact Mass | 347.94 |
| IUPAC Name | 3-bromo-5-methyl-N-[2-(methylamino)ethyl]thiophene-2-sulfonamide;hydrochloride |
| SMILES | CNCCNS(=O)(=O)c1sc(C)cc1Br.Cl |
| InChI | InChI=1S/C8H13BrN2O2S2.ClH/c1-6-5-7(9)8(14-6)15(12,13)11-4-3-10-2;/h5,10-11H,3-4H2,1-2H3;1H |
| InChIKey | UMLWOPMFPOJICI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.70 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|