C11H17BrN2O3S — CID 119973197
3-bromo-4-ethoxy-N-[2-(methylamino)ethyl]benzenesulfonamide (PubChem CID 119973197) has the molecular formula C11H17BrN2O3S and a molecular weight of 337.24 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-N-[2-(methylamino)ethyl]benzenesulfonamide.
| Compound Name | 3-bromo-4-ethoxy-N-[2-(methylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 119973197 |
| Molecular Formula | C11H17BrN2O3S |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 3-bromo-4-ethoxy-N-[2-(methylamino)ethyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCCNC)cc1Br |
| InChI | InChI=1S/C11H17BrN2O3S/c1-3-17-11-5-4-9(8-10(11)12)18(15,16)14-7-6-13-2/h4-5,8,13-14H,3,6-7H2,1-2H3 |
| InChIKey | CDAVWKYAQSVHRT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|