C13H17BrN2O3S — CID 97243604
3-bromo-N-[(2S)-2-cyanobutan-2-yl]-4-ethoxybenzenesulfonamide (PubChem CID 97243604) has the molecular formula C13H17BrN2O3S and a molecular weight of 361.26 g/mol. Its IUPAC name is 3-bromo-N-[(2S)-2-cyanobutan-2-yl]-4-ethoxybenzenesulfonamide.
| Compound Name | 3-bromo-N-[(2S)-2-cyanobutan-2-yl]-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 97243604 |
| Molecular Formula | C13H17BrN2O3S |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 3-bromo-N-[(2S)-2-cyanobutan-2-yl]-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N[C@](C)(C#N)CC)cc1Br |
| InChI | InChI=1S/C13H17BrN2O3S/c1-4-13(3,9-15)16-20(17,18)10-6-7-12(19-5-2)11(14)8-10/h6-8,16H,4-5H2,1-3H3/t13-/m0/s1 |
| InChIKey | LNJMOXWKIGKMBC-ZDUSSCGKSA-N |
| XLogP | 2.82 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |