C17H16BrN5O4S — CID 4843946
2-amino-N-[4-[(3-bromo-4-ethoxyphenyl)sulfamoyl]anilino]-2-oxoethanimidoyl cyanide (PubChem CID 4843946) has the molecular formula C17H16BrN5O4S and a molecular weight of 466.32 g/mol. Its IUPAC name is 2-amino-N-[4-[(3-bromo-4-ethoxyphenyl)sulfamoyl]anilino]-2-oxoethanimidoyl cyanide.
| Compound Name | 2-amino-N-[4-[(3-bromo-4-ethoxyphenyl)sulfamoyl]anilino]-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 4843946 |
| Molecular Formula | C17H16BrN5O4S |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 465.01 |
| IUPAC Name | 2-amino-N-[4-[(3-bromo-4-ethoxyphenyl)sulfamoyl]anilino]-2-oxoethanimidoyl cyanide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(NN=C(C#N)C(N)=O)cc2)cc1Br |
| InChI | InChI=1S/C17H16BrN5O4S/c1-2-27-16-8-5-12(9-14(16)18)23-28(25,26)13-6-3-11(4-7-13)21-22-15(10-19)17(20)24/h3-9,21,23H,2H2,1H3,(H2,20,24) |
| InChIKey | RPDCCDYCYUKCST-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 146.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|