C12H20N2O3S2 — CID 78797888
2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-3-methylpentanamide (PubChem CID 78797888) has the molecular formula C12H20N2O3S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-3-methylpentanamide.
| Compound Name | 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-3-methylpentanamide |
|---|---|
| PubChem CID | 78797888 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-3-methylpentanamide |
| SMILES | CCC(C)C(NS(=O)(=O)c1cc(C)sc1C)C(N)=O |
| InChI | InChI=1S/C12H20N2O3S2/c1-5-7(2)11(12(13)15)14-19(16,17)10-6-8(3)18-9(10)4/h6-7,11,14H,5H2,1-4H3,(H2,13,15) |
| InChIKey | WINBURLJXIZOGL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |