C15H20FNO2S — CID 106150784
N-[2-(cyclopenten-1-yl)ethyl]-4-fluoro-2,6-dimethylbenzenesulfonamide (PubChem CID 106150784) has the molecular formula C15H20FNO2S and a molecular weight of 297.39 g/mol. Its IUPAC name is N-[2-(cyclopenten-1-yl)ethyl]-4-fluoro-2,6-dimethylbenzenesulfonamide.
| Compound Name | N-[2-(cyclopenten-1-yl)ethyl]-4-fluoro-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106150784 |
| Molecular Formula | C15H20FNO2S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-[2-(cyclopenten-1-yl)ethyl]-4-fluoro-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)NCCC1=CCCC1 |
| InChI | InChI=1S/C15H20FNO2S/c1-11-9-14(16)10-12(2)15(11)20(18,19)17-8-7-13-5-3-4-6-13/h5,9-10,17H,3-4,6-8H2,1-2H3 |
| InChIKey | UFPVMWUPOGZOEJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|