C19H31NO2S — CID 7938165
4-tert-butyl-N-cycloheptyl-2,6-dimethylbenzenesulfonamide (PubChem CID 7938165) has the molecular formula C19H31NO2S and a molecular weight of 337.53 g/mol. Its IUPAC name is 4-tert-butyl-N-cycloheptyl-2,6-dimethylbenzenesulfonamide.
| Compound Name | 4-tert-butyl-N-cycloheptyl-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 7938165 |
| Molecular Formula | C19H31NO2S |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | 4-tert-butyl-N-cycloheptyl-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1S(=O)(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C19H31NO2S/c1-14-12-16(19(3,4)5)13-15(2)18(14)23(21,22)20-17-10-8-6-7-9-11-17/h12-13,17,20H,6-11H2,1-5H3 |
| InChIKey | BUGLBOBRDNUYBO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |