C13H15F2NO4S — CID 60828784
2-[cyclopentyl-(3,4-difluorophenyl)sulfonylamino]acetic acid (PubChem CID 60828784) has the molecular formula C13H15F2NO4S and a molecular weight of 319.33 g/mol. Its IUPAC name is 2-[cyclopentyl-(3,4-difluorophenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[cyclopentyl-(3,4-difluorophenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 60828784 |
| Molecular Formula | C13H15F2NO4S |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-[cyclopentyl-(3,4-difluorophenyl)sulfonylamino]acetic acid |
| SMILES | O=C(O)CN(C1CCCC1)S(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H15F2NO4S/c14-11-6-5-10(7-12(11)15)21(19,20)16(8-13(17)18)9-3-1-2-4-9/h5-7,9H,1-4,8H2,(H,17,18) |
| InChIKey | LMUMVDSTALKFNL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |