C16H17F2NO3S — CID 87032912
N-cyclopentyl-3,4-difluoro-N-(furan-2-ylmethyl)benzenesulfonamide (PubChem CID 87032912) has the molecular formula C16H17F2NO3S and a molecular weight of 341.38 g/mol. Its IUPAC name is N-cyclopentyl-3,4-difluoro-N-(furan-2-ylmethyl)benzenesulfonamide.
| Compound Name | N-cyclopentyl-3,4-difluoro-N-(furan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 87032912 |
| Molecular Formula | C16H17F2NO3S |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-cyclopentyl-3,4-difluoro-N-(furan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1)N(Cc1ccco1)C1CCCC1 |
| InChI | InChI=1S/C16H17F2NO3S/c17-15-8-7-14(10-16(15)18)23(20,21)19(12-4-1-2-5-12)11-13-6-3-9-22-13/h3,6-10,12H,1-2,4-5,11H2 |
| InChIKey | QIBJXTJEIUXCQV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |