C18H22ClNO3S — CID 55828003
N-[2-(4-chlorophenyl)sulfonylethyl]-N-(furan-2-ylmethyl)cyclopentanamine (PubChem CID 55828003) has the molecular formula C18H22ClNO3S and a molecular weight of 367.90 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfonylethyl]-N-(furan-2-ylmethyl)cyclopentanamine.
| Compound Name | N-[2-(4-chlorophenyl)sulfonylethyl]-N-(furan-2-ylmethyl)cyclopentanamine |
|---|---|
| PubChem CID | 55828003 |
| Molecular Formula | C18H22ClNO3S |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfonylethyl]-N-(furan-2-ylmethyl)cyclopentanamine |
| SMILES | O=S(=O)(CCN(Cc1ccco1)C1CCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22ClNO3S/c19-15-7-9-18(10-8-15)24(21,22)13-11-20(16-4-1-2-5-16)14-17-6-3-12-23-17/h3,6-10,12,16H,1-2,4-5,11,13-14H2 |
| InChIKey | BXDUYNORNYQDKD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |