C17H23N3O4S2 — CID 20937330
4-[2-[cyclopentyl(furan-2-ylmethyl)amino]ethylsulfamoyl]thiophene-2-carboxamide (PubChem CID 20937330) has the molecular formula C17H23N3O4S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 4-[2-[cyclopentyl(furan-2-ylmethyl)amino]ethylsulfamoyl]thiophene-2-carboxamide.
| Compound Name | 4-[2-[cyclopentyl(furan-2-ylmethyl)amino]ethylsulfamoyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 20937330 |
| Molecular Formula | C17H23N3O4S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 4-[2-[cyclopentyl(furan-2-ylmethyl)amino]ethylsulfamoyl]thiophene-2-carboxamide |
| SMILES | NC(=O)c1cc(S(=O)(=O)NCCN(Cc2ccco2)C2CCCC2)cs1 |
| InChI | InChI=1S/C17H23N3O4S2/c18-17(21)16-10-15(12-25-16)26(22,23)19-7-8-20(13-4-1-2-5-13)11-14-6-3-9-24-14/h3,6,9-10,12-13,19H,1-2,4-5,7-8,11H2,(H2,18,21) |
| InChIKey | YDOGEKKRGCKBOA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |