C16H22N2OS — CID 62556371
N'-cyclopropyl-N'-(furan-2-ylmethyl)-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine (PubChem CID 62556371) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is N'-cyclopropyl-N'-(furan-2-ylmethyl)-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine.
| Compound Name | N'-cyclopropyl-N'-(furan-2-ylmethyl)-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62556371 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N'-cyclopropyl-N'-(furan-2-ylmethyl)-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine |
| SMILES | c1coc(CN(CCNCCc2cccs2)C2CC2)c1 |
| InChI | InChI=1S/C16H22N2OS/c1-3-15(19-11-1)13-18(14-5-6-14)10-9-17-8-7-16-4-2-12-20-16/h1-4,11-12,14,17H,5-10,13H2 |
| InChIKey | CWJAEZVASDCOQH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|