C15H19ClN2S2 — CID 62557593
N-[(5-chlorothiophen-2-yl)methyl]-N'-cyclopropyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine (PubChem CID 62557593) has the molecular formula C15H19ClN2S2 and a molecular weight of 326.92 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N'-cyclopropyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N'-cyclopropyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62557593 |
| Molecular Formula | C15H19ClN2S2 |
| Molecular Weight | 326.92 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N'-cyclopropyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine |
| SMILES | Clc1ccc(CNCCN(Cc2cccs2)C2CC2)s1 |
| InChI | InChI=1S/C15H19ClN2S2/c16-15-6-5-13(20-15)10-17-7-8-18(12-3-4-12)11-14-2-1-9-19-14/h1-2,5-6,9,12,17H,3-4,7-8,10-11H2 |
| InChIKey | DFUXGQRIEBFFTG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.92 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|