C13H13NO2S2 — CID 107026650
N-cyclopropyl-N-(furan-2-ylmethyl)-4-sulfanylthiophene-2-carboxamide (PubChem CID 107026650) has the molecular formula C13H13NO2S2 and a molecular weight of 279.39 g/mol. Its IUPAC name is N-cyclopropyl-N-(furan-2-ylmethyl)-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-cyclopropyl-N-(furan-2-ylmethyl)-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107026650 |
| Molecular Formula | C13H13NO2S2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | N-cyclopropyl-N-(furan-2-ylmethyl)-4-sulfanylthiophene-2-carboxamide |
| SMILES | O=C(c1cc(S)cs1)N(Cc1ccco1)C1CC1 |
| InChI | InChI=1S/C13H13NO2S2/c15-13(12-6-11(17)8-18-12)14(9-3-4-9)7-10-2-1-5-16-10/h1-2,5-6,8-9,17H,3-4,7H2 |
| InChIKey | RYRQPMTWTLLSQT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 33.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|