C10H10F3NOS2 — CID 107026729
N-cyclopropyl-4-sulfanyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide (PubChem CID 107026729) has the molecular formula C10H10F3NOS2 and a molecular weight of 281.32 g/mol. Its IUPAC name is N-cyclopropyl-4-sulfanyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide.
| Compound Name | N-cyclopropyl-4-sulfanyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 107026729 |
| Molecular Formula | C10H10F3NOS2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | N-cyclopropyl-4-sulfanyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide |
| SMILES | O=C(c1cc(S)cs1)N(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C10H10F3NOS2/c11-10(12,13)5-14(6-1-2-6)9(15)8-3-7(16)4-17-8/h3-4,6,16H,1-2,5H2 |
| InChIKey | AKFJWGSFEYQJIY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|