C8H8F3NOS2 — CID 107023496
N-methyl-4-sulfanyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide (PubChem CID 107023496) has the molecular formula C8H8F3NOS2 and a molecular weight of 255.29 g/mol. Its IUPAC name is N-methyl-4-sulfanyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide.
| Compound Name | N-methyl-4-sulfanyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 107023496 |
| Molecular Formula | C8H8F3NOS2 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | N-methyl-4-sulfanyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide |
| SMILES | CN(CC(F)(F)F)C(=O)c1cc(S)cs1 |
| InChI | InChI=1S/C8H8F3NOS2/c1-12(4-8(9,10)11)7(13)6-2-5(14)3-15-6/h2-3,14H,4H2,1H3 |
| InChIKey | ZOTBAMUDNPQKSB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|