C14H15ClN2O3S — CID 61112354
2-amino-5-chloro-N-cyclopropyl-N-(furan-2-ylmethyl)benzenesulfonamide (PubChem CID 61112354) has the molecular formula C14H15ClN2O3S and a molecular weight of 326.81 g/mol. Its IUPAC name is 2-amino-5-chloro-N-cyclopropyl-N-(furan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 2-amino-5-chloro-N-cyclopropyl-N-(furan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61112354 |
| Molecular Formula | C14H15ClN2O3S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-amino-5-chloro-N-cyclopropyl-N-(furan-2-ylmethyl)benzenesulfonamide |
| SMILES | Nc1ccc(Cl)cc1S(=O)(=O)N(Cc1ccco1)C1CC1 |
| InChI | InChI=1S/C14H15ClN2O3S/c15-10-3-6-13(16)14(8-10)21(18,19)17(11-4-5-11)9-12-2-1-7-20-12/h1-3,6-8,11H,4-5,9,16H2 |
| InChIKey | BKDWCYQQJKAIBC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|