C15H18N2O3S — CID 61111599
1-(4-aminophenyl)-N-cyclopropyl-N-(furan-2-ylmethyl)methanesulfonamide (PubChem CID 61111599) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 1-(4-aminophenyl)-N-cyclopropyl-N-(furan-2-ylmethyl)methanesulfonamide.
| Compound Name | 1-(4-aminophenyl)-N-cyclopropyl-N-(furan-2-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 61111599 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-(4-aminophenyl)-N-cyclopropyl-N-(furan-2-ylmethyl)methanesulfonamide |
| SMILES | Nc1ccc(CS(=O)(=O)N(Cc2ccco2)C2CC2)cc1 |
| InChI | InChI=1S/C15H18N2O3S/c16-13-5-3-12(4-6-13)11-21(18,19)17(14-7-8-14)10-15-2-1-9-20-15/h1-6,9,14H,7-8,10-11,16H2 |
| InChIKey | LCDSXXCCAQZLNQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|