C14H14Cl2N2O — CID 106890198
2,6-dichloro-1-N-cyclopropyl-1-N-(furan-2-ylmethyl)benzene-1,4-diamine (PubChem CID 106890198) has the molecular formula C14H14Cl2N2O and a molecular weight of 297.19 g/mol. Its IUPAC name is 2,6-dichloro-1-N-cyclopropyl-1-N-(furan-2-ylmethyl)benzene-1,4-diamine.
| Compound Name | 2,6-dichloro-1-N-cyclopropyl-1-N-(furan-2-ylmethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 106890198 |
| Molecular Formula | C14H14Cl2N2O |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2,6-dichloro-1-N-cyclopropyl-1-N-(furan-2-ylmethyl)benzene-1,4-diamine |
| SMILES | Nc1cc(Cl)c(N(Cc2ccco2)C2CC2)c(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N2O/c15-12-6-9(17)7-13(16)14(12)18(10-3-4-10)8-11-2-1-5-19-11/h1-2,5-7,10H,3-4,8,17H2 |
| InChIKey | WJVBZUCQTCIFIQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|