C13H16N4O — CID 79827765
6-N-cyclopropyl-6-N-(furan-2-ylmethyl)pyridine-2,3,6-triamine (PubChem CID 79827765) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 6-N-cyclopropyl-6-N-(furan-2-ylmethyl)pyridine-2,3,6-triamine.
| Compound Name | 6-N-cyclopropyl-6-N-(furan-2-ylmethyl)pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 79827765 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 6-N-cyclopropyl-6-N-(furan-2-ylmethyl)pyridine-2,3,6-triamine |
| SMILES | Nc1ccc(N(Cc2ccco2)C2CC2)nc1N |
| InChI | InChI=1S/C13H16N4O/c14-11-5-6-12(16-13(11)15)17(9-3-4-9)8-10-2-1-7-18-10/h1-2,5-7,9H,3-4,8,14H2,(H2,15,16) |
| InChIKey | BEJDAXWBTGOPIE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |