About 3-[cyclopropyl-(5,6-diamino-2-pyridinyl)amino]propanenitrile
3-[cyclopropyl-(5,6-diamino-2-pyridinyl)amino]propanenitrile (PubChem CID 79825815) has the molecular formula C11H15N5
and a molecular weight of 217.28 g/mol. Its IUPAC name is 3-[cyclopropyl-(5,6-diamino-2-pyridinyl)amino]propanenitrile.
Molecular Properties
| Compound Name | 3-[cyclopropyl-(5,6-diamino-2-pyridinyl)amino]propanenitrile |
| PubChem CID | 79825815 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 3-[cyclopropyl-(5,6-diamino-2-pyridinyl)amino]propanenitrile |
| SMILES | N#CCCN(c1ccc(N)c(N)n1)C1CC1 |
| InChI | InChI=1S/C11H15N5/c12-6-1-7-16(8-2-3-8)10-5-4-9(13)11(14)15-10/h4-5,8H,1-3,7,13H2,(H2,14,15) |
| InChIKey | MKKIXXAVGRZMGQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[cyclopropyl-(5,6-diamino-2-pyridinyl)amino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[cyclopropyl-(5,6-diamino-2-pyridinyl)amino]propanenitrile?
The IUPAC name of 3-[cyclopropyl-(5,6-diamino-2-pyridinyl)amino]propanenitrile (CID 79825815) is 3-[cyclopropyl-(5,6-diamino-2-pyridinyl)amino]propanenitrile.
What is the SMILES notation for 3-[cyclopropyl-(5,6-diamino-2-pyridinyl)amino]propanenitrile?
The canonical SMILES for 3-[cyclopropyl-(5,6-diamino-2-pyridinyl)amino]propanenitrile is N#CCCN(c1ccc(N)c(N)n1)C1CC1.
What is the InChIKey of 3-[cyclopropyl-(5,6-diamino-2-pyridinyl)amino]propanenitrile?
The InChIKey is MKKIXXAVGRZMGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5/c12-6-1-7-16(8-2-3-8)10-5-4-9(13)11(14)15-10/h4-5,8H,1-3,7,13H2,(H2,14,15).
What are the key properties of 3-[cyclopropyl-(5,6-diamino-2-pyridinyl)amino]propanenitrile?
3-[cyclopropyl-(5,6-diamino-2-pyridinyl)amino]propanenitrile has a molecular weight of 217.28 g/mol, XLogP of 1.13, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[cyclopropyl-(5,6-diamino-2-pyridinyl)amino]propanenitrile is sourced from PubChem (CID 79825815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).