C15H16N2O3 — CID 115934626
3-amino-2-[cyclopropyl(furan-2-ylmethyl)amino]benzoic acid (PubChem CID 115934626) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 3-amino-2-[cyclopropyl(furan-2-ylmethyl)amino]benzoic acid.
| Compound Name | 3-amino-2-[cyclopropyl(furan-2-ylmethyl)amino]benzoic acid |
|---|---|
| PubChem CID | 115934626 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 3-amino-2-[cyclopropyl(furan-2-ylmethyl)amino]benzoic acid |
| SMILES | Nc1cccc(C(=O)O)c1N(Cc1ccco1)C1CC1 |
| InChI | InChI=1S/C15H16N2O3/c16-13-5-1-4-12(15(18)19)14(13)17(10-6-7-10)9-11-3-2-8-20-11/h1-5,8,10H,6-7,9,16H2,(H,18,19) |
| InChIKey | HQMADWOGLRGMKD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|