C13H12Cl2N2O3S — CID 64608208
5,6-dichloro-N-cyclopropyl-N-(furan-2-ylmethyl)pyridine-3-sulfonamide (PubChem CID 64608208) has the molecular formula C13H12Cl2N2O3S and a molecular weight of 347.22 g/mol. Its IUPAC name is 5,6-dichloro-N-cyclopropyl-N-(furan-2-ylmethyl)pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-cyclopropyl-N-(furan-2-ylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64608208 |
| Molecular Formula | C13H12Cl2N2O3S |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 5,6-dichloro-N-cyclopropyl-N-(furan-2-ylmethyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(c1cnc(Cl)c(Cl)c1)N(Cc1ccco1)C1CC1 |
| InChI | InChI=1S/C13H12Cl2N2O3S/c14-12-6-11(7-16-13(12)15)21(18,19)17(9-3-4-9)8-10-2-1-5-20-10/h1-2,5-7,9H,3-4,8H2 |
| InChIKey | QUFQRGLVDXSNBX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|