C18H21NO6S — CID 47064760
methyl 3-[4-[cyclopropyl(furan-2-ylmethyl)sulfamoyl]phenoxy]propanoate (PubChem CID 47064760) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is methyl 3-[4-[cyclopropyl(furan-2-ylmethyl)sulfamoyl]phenoxy]propanoate.
| Compound Name | methyl 3-[4-[cyclopropyl(furan-2-ylmethyl)sulfamoyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 47064760 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | methyl 3-[4-[cyclopropyl(furan-2-ylmethyl)sulfamoyl]phenoxy]propanoate |
| SMILES | COC(=O)CCOc1ccc(S(=O)(=O)N(Cc2ccco2)C2CC2)cc1 |
| InChI | InChI=1S/C18H21NO6S/c1-23-18(20)10-12-25-15-6-8-17(9-7-15)26(21,22)19(14-4-5-14)13-16-3-2-11-24-16/h2-3,6-9,11,14H,4-5,10,12-13H2,1H3 |
| InChIKey | IMCMNLRTYQKXCF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |