C13H17N3O3S — CID 47268204
N-cyclopentyl-N-(furan-2-ylmethyl)-1H-pyrazole-4-sulfonamide (PubChem CID 47268204) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is N-cyclopentyl-N-(furan-2-ylmethyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N-cyclopentyl-N-(furan-2-ylmethyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 47268204 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-cyclopentyl-N-(furan-2-ylmethyl)-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(c1cn[nH]c1)N(Cc1ccco1)C1CCCC1 |
| InChI | InChI=1S/C13H17N3O3S/c17-20(18,13-8-14-15-9-13)16(11-4-1-2-5-11)10-12-6-3-7-19-12/h3,6-9,11H,1-2,4-5,10H2,(H,14,15) |
| InChIKey | ISYXVZOYPWISPP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |