C12H17FN2O2S — CID 43136997
N-(3-aminopropyl)-N-cyclopropyl-3-fluorobenzenesulfonamide (PubChem CID 43136997) has the molecular formula C12H17FN2O2S and a molecular weight of 272.34 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-cyclopropyl-3-fluorobenzenesulfonamide.
| Compound Name | N-(3-aminopropyl)-N-cyclopropyl-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 43136997 |
| Molecular Formula | C12H17FN2O2S |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | N-(3-aminopropyl)-N-cyclopropyl-3-fluorobenzenesulfonamide |
| SMILES | NCCCN(C1CC1)S(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C12H17FN2O2S/c13-10-3-1-4-12(9-10)18(16,17)15(8-2-7-14)11-5-6-11/h1,3-4,9,11H,2,5-8,14H2 |
| InChIKey | DZPQEWHRLYSXDU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |