C11H15BrN2O4S2 — CID 81039604
5-amino-2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]benzenesulfonamide (PubChem CID 81039604) has the molecular formula C11H15BrN2O4S2 and a molecular weight of 383.29 g/mol. Its IUPAC name is 5-amino-2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]benzenesulfonamide.
| Compound Name | 5-amino-2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 81039604 |
| Molecular Formula | C11H15BrN2O4S2 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | 5-amino-2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]benzenesulfonamide |
| SMILES | Nc1ccc(Br)c(S(=O)(=O)NCC2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C11H15BrN2O4S2/c12-10-4-3-8(13)6-11(10)20(17,18)14-7-9-2-1-5-19(9,15)16/h3-4,6,9,14H,1-2,5,7,13H2 |
| InChIKey | JNJMVXIDBKZTSP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|