C12H17ClN2O4S2 — CID 81041486
3-amino-5-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]-4-methylbenzenesulfonamide (PubChem CID 81041486) has the molecular formula C12H17ClN2O4S2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 3-amino-5-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | 3-amino-5-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 81041486 |
| Molecular Formula | C12H17ClN2O4S2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 3-amino-5-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1c(N)cc(S(=O)(=O)NCC2CCCS2(=O)=O)cc1Cl |
| InChI | InChI=1S/C12H17ClN2O4S2/c1-8-11(13)5-10(6-12(8)14)21(18,19)15-7-9-3-2-4-20(9,16)17/h5-6,9,15H,2-4,7,14H2,1H3 |
| InChIKey | PZJZQTPVMFOBQL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|