C10H14N2O5S2 — CID 81040838
N-[(1,1-dioxothiolan-2-yl)methyl]-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 81040838) has the molecular formula C10H14N2O5S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-2-yl)methyl]-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | N-[(1,1-dioxothiolan-2-yl)methyl]-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 81040838 |
| Molecular Formula | C10H14N2O5S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | N-[(1,1-dioxothiolan-2-yl)methyl]-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | O=c1ccc(S(=O)(=O)NCC2CCCS2(=O)=O)c[nH]1 |
| InChI | InChI=1S/C10H14N2O5S2/c13-10-4-3-9(6-11-10)19(16,17)12-7-8-2-1-5-18(8,14)15/h3-4,6,8,12H,1-2,5,7H2,(H,11,13) |
| InChIKey | DWTNHXYJTZUQSH-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |