C23H29N5O4S2 — CID 173179448
N-[[(4S)-4-amino-1-(1,3-benzothiazol-2-yl)-5-oxopentyl]amino]-N'-(4-methoxy-2,3,6-trimethylphenyl)sulfonylmethanimidamide (PubChem CID 173179448) has the molecular formula C23H29N5O4S2 and a molecular weight of 503.65 g/mol. Its IUPAC name is N-[[(4S)-4-amino-1-(1,3-benzothiazol-2-yl)-5-oxopentyl]amino]-N'-(4-methoxy-2,3,6-trimethylphenyl)sulfonylmethanimidamide.
| Compound Name | N-[[(4S)-4-amino-1-(1,3-benzothiazol-2-yl)-5-oxopentyl]amino]-N'-(4-methoxy-2,3,6-trimethylphenyl)sulfonylmethanimidamide |
|---|---|
| PubChem CID | 173179448 |
| Molecular Formula | C23H29N5O4S2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | N-[[(4S)-4-amino-1-(1,3-benzothiazol-2-yl)-5-oxopentyl]amino]-N'-(4-methoxy-2,3,6-trimethylphenyl)sulfonylmethanimidamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N=CNNC(CC[C@H](N)C=O)c2nc3ccccc3s2)c(C)c1C |
| InChI | InChI=1S/C23H29N5O4S2/c1-14-11-20(32-4)15(2)16(3)22(14)34(30,31)26-13-25-28-19(10-9-17(24)12-29)23-27-18-7-5-6-8-21(18)33-23/h5-8,11-13,17,19,28H,9-10,24H2,1-4H3,(H,25,26)/t17-,19?/m0/s1 |
| InChIKey | YHVMWJSPDKNYRO-KKFHFHRHSA-N |
| XLogP | 3.09 |
| TPSA | 135.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|