C19H25N3O2S — CID 158252985
N-[(2S)-1-(1,3-benzothiazol-2-yl)-7-imino-1-oxooctan-2-yl]butanamide (PubChem CID 158252985) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is N-[(2S)-1-(1,3-benzothiazol-2-yl)-7-imino-1-oxooctan-2-yl]butanamide.
| Compound Name | N-[(2S)-1-(1,3-benzothiazol-2-yl)-7-imino-1-oxooctan-2-yl]butanamide |
|---|---|
| PubChem CID | 158252985 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-[(2S)-1-(1,3-benzothiazol-2-yl)-7-imino-1-oxooctan-2-yl]butanamide |
| SMILES | [H]/N=C(\C)CCCC[C@H](NC(=O)CCC)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H25N3O2S/c1-3-8-17(23)21-15(11-5-4-9-13(2)20)18(24)19-22-14-10-6-7-12-16(14)25-19/h6-7,10,12,15,20H,3-5,8-9,11H2,1-2H3,(H,21,23)/b20-13+/t15-/m0/s1 |
| InChIKey | JNYMMNRDUCORIA-NPRIEWAGSA-N |
| XLogP | 4.36 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|