C22H34N4O5 — CID 150229824
benzyl N-[(5S)-6-amino-5-[[(2S)-2-amino-3-(oxan-4-yl)propanoyl]amino]-6-oxohexyl]carbamate (PubChem CID 150229824) has the molecular formula C22H34N4O5 and a molecular weight of 434.54 g/mol. Its IUPAC name is benzyl N-[(5S)-6-amino-5-[[(2S)-2-amino-3-(oxan-4-yl)propanoyl]amino]-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[(5S)-6-amino-5-[[(2S)-2-amino-3-(oxan-4-yl)propanoyl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 150229824 |
| Molecular Formula | C22H34N4O5 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | benzyl N-[(5S)-6-amino-5-[[(2S)-2-amino-3-(oxan-4-yl)propanoyl]amino]-6-oxohexyl]carbamate |
| SMILES | NC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)[C@@H](N)CC1CCOCC1 |
| InChI | InChI=1S/C22H34N4O5/c23-18(14-16-9-12-30-13-10-16)21(28)26-19(20(24)27)8-4-5-11-25-22(29)31-15-17-6-2-1-3-7-17/h1-3,6-7,16,18-19H,4-5,8-15,23H2,(H2,24,27)(H,25,29)(H,26,28)/t18-,19-/m0/s1 |
| InChIKey | FVFVMDZCLGDSQP-OALUTQOASA-N |
| XLogP | 1.20 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|