C38H55N9O9 — CID 175177659
benzyl N-[6-amino-5-[[2-[[2-[(2-carbamoyloxy-3-phenylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(oxan-4-yl)propanoyl]amino]-6-oxohexyl]carbamate (PubChem CID 175177659) has the molecular formula C38H55N9O9 and a molecular weight of 781.91 g/mol. Its IUPAC name is benzyl N-[6-amino-5-[[2-[[2-[(2-carbamoyloxy-3-phenylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(oxan-4-yl)propanoyl]amino]-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[6-amino-5-[[2-[[2-[(2-carbamoyloxy-3-phenylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(oxan-4-yl)propanoyl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 175177659 |
| Molecular Formula | C38H55N9O9 |
| Molecular Weight | 781.91 g/mol |
| Exact Mass | 781.41 |
| IUPAC Name | benzyl N-[6-amino-5-[[2-[[2-[(2-carbamoyloxy-3-phenylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(oxan-4-yl)propanoyl]amino]-6-oxohexyl]carbamate |
| SMILES | NC(=O)OC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC1CCOCC1)C(=O)NC(CCCCNC(=O)OCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C38H55N9O9/c39-32(48)28(14-7-8-18-44-38(53)55-24-27-12-5-2-6-13-27)45-34(50)30(22-26-16-20-54-21-17-26)47-33(49)29(15-9-19-43-36(40)41)46-35(51)31(56-37(42)52)23-25-10-3-1-4-11-25/h1-6,10-13,26,28-31H,7-9,14-24H2,(H2,39,48)(H2,42,52)(H,44,53)(H,45,50)(H,46,51)(H,47,49)(H4,40,41,43) |
| InChIKey | ZIOWVEITRSZIOV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 294.67 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.91 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|