C29H44N4O7 — CID 10482933
benzyl 3-[[1-[(2S)-2-acetamido-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]piperidine-3-carbonyl]amino]propanoate (PubChem CID 10482933) has the molecular formula C29H44N4O7 and a molecular weight of 560.69 g/mol. Its IUPAC name is benzyl 3-[[1-[(2S)-2-acetamido-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]piperidine-3-carbonyl]amino]propanoate.
| Compound Name | benzyl 3-[[1-[(2S)-2-acetamido-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]piperidine-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 10482933 |
| Molecular Formula | C29H44N4O7 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | benzyl 3-[[1-[(2S)-2-acetamido-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]piperidine-3-carbonyl]amino]propanoate |
| SMILES | CC(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)C(=O)N1CCCC(C(=O)NCCC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C29H44N4O7/c1-21(34)32-24(14-8-9-16-31-28(38)40-29(2,3)4)27(37)33-18-10-13-23(19-33)26(36)30-17-15-25(35)39-20-22-11-6-5-7-12-22/h5-7,11-12,23-24H,8-10,13-20H2,1-4H3,(H,30,36)(H,31,38)(H,32,34)/t23?,24-/m0/s1 |
| InChIKey | FPZKRXDNSRKIBA-CGAIIQECSA-N |
| XLogP | 2.67 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|