C24H27N3O4 — CID 10047813
benzyl 3-[[1-[(E)-3-pyridin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]propanoate (PubChem CID 10047813) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is benzyl 3-[[1-[(E)-3-pyridin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]propanoate.
| Compound Name | benzyl 3-[[1-[(E)-3-pyridin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 10047813 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | benzyl 3-[[1-[(E)-3-pyridin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]propanoate |
| SMILES | O=C(CCNC(=O)C1CCCN(C(=O)/C=C/c2ccncc2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C24H27N3O4/c28-22(9-8-19-10-13-25-14-11-19)27-16-4-7-21(17-27)24(30)26-15-12-23(29)31-18-20-5-2-1-3-6-20/h1-3,5-6,8-11,13-14,21H,4,7,12,15-18H2,(H,26,30)/b9-8+ |
| InChIKey | CNGJZIYPLREUDO-CMDGGOBGSA-N |
| XLogP | 2.58 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|