C21H35N3O4 — CID 70092628
butyl 3-[[(3R)-1-[(E)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]propanoate (PubChem CID 70092628) has the molecular formula C21H35N3O4 and a molecular weight of 393.53 g/mol. Its IUPAC name is butyl 3-[[(3R)-1-[(E)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]propanoate.
| Compound Name | butyl 3-[[(3R)-1-[(E)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 70092628 |
| Molecular Formula | C21H35N3O4 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | butyl 3-[[(3R)-1-[(E)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]propanoate |
| SMILES | CCCCOC(=O)CCNC(=O)[C@@H]1CCCN(C(=O)/C=C/C2CCNCC2)C1 |
| InChI | InChI=1S/C21H35N3O4/c1-2-3-15-28-20(26)10-13-23-21(27)18-5-4-14-24(16-18)19(25)7-6-17-8-11-22-12-9-17/h6-7,17-18,22H,2-5,8-16H2,1H3,(H,23,27)/b7-6+/t18-/m1/s1 |
| InChIKey | MCGVSYWRVFLEME-IPLHWJFFSA-N |
| XLogP | 1.63 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|