C21H28ClN3O4 — CID 70094187
4-[[(3R)-1-[(E)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]benzoic acid;hydrochloride (PubChem CID 70094187) has the molecular formula C21H28ClN3O4 and a molecular weight of 421.93 g/mol. Its IUPAC name is 4-[[(3R)-1-[(E)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]benzoic acid;hydrochloride.
| Compound Name | 4-[[(3R)-1-[(E)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 70094187 |
| Molecular Formula | C21H28ClN3O4 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 4-[[(3R)-1-[(E)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(NC(=O)[C@@H]2CCCN(C(=O)/C=C/C3CCNCC3)C2)cc1 |
| InChI | InChI=1S/C21H27N3O4.ClH/c25-19(8-3-15-9-11-22-12-10-15)24-13-1-2-17(14-24)20(26)23-18-6-4-16(5-7-18)21(27)28;/h3-8,15,17,22H,1-2,9-14H2,(H,23,26)(H,27,28);1H/b8-3+;/t17-;/m1./s1 |
| InChIKey | FOHYWUBMJLLDLS-WCWJSKHOSA-N |
| XLogP | 2.54 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|